C37H51F2N3O3 — CID 138659741
tert-butyl (2S)-2-[(3S)-4-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]-3-methylpiperazin-1-yl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate (PubChem CID 138659741) has the molecular formula C37H51F2N3O3 and a molecular weight of 623.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S)-4-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]-3-methylpiperazin-1-yl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate.
| Compound Name | tert-butyl (2S)-2-[(3S)-4-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]-3-methylpiperazin-1-yl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 138659741 |
| Molecular Formula | C37H51F2N3O3 |
| Molecular Weight | 623.83 g/mol |
| Exact Mass | 623.39 |
| IUPAC Name | tert-butyl (2S)-2-[(3S)-4-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]-3-methylpiperazin-1-yl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoate |
| SMILES | C[C@H]1CN([C@@H](Cc2ccc3c(c2)CCCC3)C(=O)OC(C)(C)C)CCN1C(=O)[C@@H]1CN(C(C)(C)C)C[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C37H51F2N3O3/c1-24-21-40(33(35(44)45-37(5,6)7)19-25-12-13-26-10-8-9-11-27(26)18-25)16-17-42(24)34(43)31-23-41(36(2,3)4)22-30(31)29-15-14-28(38)20-32(29)39/h12-15,18,20,24,30-31,33H,8-11,16-17,19,21-23H2,1-7H3/t24-,30-,31+,33-/m0/s1 |
| InChIKey | DMGFQZKAJOAZFC-FYJKFJNMSA-N |
| XLogP | 6.14 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.83 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |