C15H27NO2 — CID 138660439
(4'aR,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-2,3,4,4a,7,8-hexahydro-1H-naphthalene]-1'-amine (PubChem CID 138660439) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (4'aR,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-2,3,4,4a,7,8-hexahydro-1H-naphthalene]-1'-amine.
| Compound Name | (4'aR,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-2,3,4,4a,7,8-hexahydro-1H-naphthalene]-1'-amine |
|---|---|
| PubChem CID | 138660439 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (4'aR,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-2,3,4,4a,7,8-hexahydro-1H-naphthalene]-1'-amine |
| SMILES | CC1(C)[C@@H]2CCCC(N)[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C15H27NO2/c1-13(2)11-5-4-6-12(16)14(11,3)7-8-15(13)17-9-10-18-15/h11-12H,4-10,16H2,1-3H3/t11-,12?,14-/m0/s1 |
| InChIKey | NLMZKAXUDOSDQS-PSIKVXPXSA-N |
| XLogP | 2.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |