C15H20F3NO2 — CID 138660483
(4aR,7S,8aR)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-(trifluoromethyl)-1,2,4a,5,6,8-hexahydronaphthalene-2-carbonitrile (PubChem CID 138660483) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is (4aR,7S,8aR)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-(trifluoromethyl)-1,2,4a,5,6,8-hexahydronaphthalene-2-carbonitrile.
| Compound Name | (4aR,7S,8aR)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-(trifluoromethyl)-1,2,4a,5,6,8-hexahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 138660483 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (4aR,7S,8aR)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-(trifluoromethyl)-1,2,4a,5,6,8-hexahydronaphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)C[C@]2(C)C[C@](O)(C(F)(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C15H20F3NO2/c1-12(2)10-4-5-14(21,15(16,17)18)8-13(10,3)6-9(7-19)11(12)20/h9-10,21H,4-6,8H2,1-3H3/t9?,10-,13+,14-/m0/s1 |
| InChIKey | RVBJENMSGQQGEK-LBLJTAPMSA-N |
| XLogP | 3.22 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|