C42H78N2 — CID 138662156
N-[(2-ethyl-3,3,4-trimethylcycloheptyl)methyl]-N-methyl-4-pentyl-3-[(Z)-prop-1-enyl]-N'-(5,5,9-trimethyl-2,3,4,4a,6,7,8,9-octahydrobenzo[7]annulen-6-yl)hexane-1,6-diamine (PubChem CID 138662156) has the molecular formula C42H78N2 and a molecular weight of 611.10 g/mol. Its IUPAC name is N-[(2-ethyl-3,3,4-trimethylcycloheptyl)methyl]-N-methyl-4-pentyl-3-[(Z)-prop-1-enyl]-N'-(5,5,9-trimethyl-2,3,4,4a,6,7,8,9-octahydrobenzo[7]annulen-6-yl)hexane-1,6-diamine.
| Compound Name | N-[(2-ethyl-3,3,4-trimethylcycloheptyl)methyl]-N-methyl-4-pentyl-3-[(Z)-prop-1-enyl]-N'-(5,5,9-trimethyl-2,3,4,4a,6,7,8,9-octahydrobenzo[7]annulen-6-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 138662156 |
| Molecular Formula | C42H78N2 |
| Molecular Weight | 611.10 g/mol |
| Exact Mass | 610.62 |
| IUPAC Name | N-[(2-ethyl-3,3,4-trimethylcycloheptyl)methyl]-N-methyl-4-pentyl-3-[(Z)-prop-1-enyl]-N'-(5,5,9-trimethyl-2,3,4,4a,6,7,8,9-octahydrobenzo[7]annulen-6-yl)hexane-1,6-diamine |
| SMILES | C/C=C\C(CCN(C)CC1CCCC(C)C(C)(C)C1CC)C(CCCCC)CCNC1CCC(C)C2=CCCCC2C1(C)C |
| InChI | InChI=1S/C42H78N2/c1-11-14-15-21-35(27-29-43-40-26-25-32(4)37-23-16-17-24-39(37)42(40,8)9)34(19-12-2)28-30-44(10)31-36-22-18-20-33(5)41(6,7)38(36)13-3/h12,19,23,32-36,38-40,43H,11,13-18,20-22,24-31H2,1-10H3/b19-12- |
| InChIKey | XRDVTOPYFZRJQA-UNOMPAQXSA-N |
| XLogP | 11.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.10 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|