C21H18F3NO4S — CID 138662309
2-[3-[(4,4-difluoro-1,1-dioxo-2,3-dihydrothiochromen-6-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 138662309) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[3-[(4,4-difluoro-1,1-dioxo-2,3-dihydrothiochromen-6-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(4,4-difluoro-1,1-dioxo-2,3-dihydrothiochromen-6-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 138662309 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[3-[(4,4-difluoro-1,1-dioxo-2,3-dihydrothiochromen-6-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccc3c(c2)C(F)(F)CCS3(=O)=O)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C21H18F3NO4S/c1-12-15(16-10-14(22)3-4-18(16)25(12)11-20(26)27)8-13-2-5-19-17(9-13)21(23,24)6-7-30(19,28)29/h2-5,9-10H,6-8,11H2,1H3,(H,26,27) |
| InChIKey | JNVICOHQHMMCOX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|