C21H21FN2O4S — CID 138662352
ethyl 2-[3-[(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 138662352) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl 2-[3-[(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 138662352 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl 2-[3-[(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(Cc2ccc3c(c2)CNS3(=O)=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H21FN2O4S/c1-3-28-21(25)12-24-13(2)17(18-10-16(22)5-6-19(18)24)9-14-4-7-20-15(8-14)11-23-29(20,26)27/h4-8,10,23H,3,9,11-12H2,1-2H3 |
| InChIKey | TWKFDKNHHHRQPO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|