C19H16FNO4S — CID 138662373
2-[3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 138662373) has the molecular formula C19H16FNO4S and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 138662373 |
| Molecular Formula | C19H16FNO4S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2CS(=O)(=O)c3ccccc32)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C19H16FNO4S/c1-11-19(15-10-26(24,25)17-5-3-2-4-13(15)17)14-8-12(20)6-7-16(14)21(11)9-18(22)23/h2-8,15H,9-10H2,1H3,(H,22,23) |
| InChIKey | OXLKHBATJWAUCP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|