C22H22FNO4S — CID 138662408
2-[3-[(3,3-dimethyl-1,1-dioxo-2H-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 138662408) has the molecular formula C22H22FNO4S and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[3-[(3,3-dimethyl-1,1-dioxo-2H-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(3,3-dimethyl-1,1-dioxo-2H-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 138662408 |
| Molecular Formula | C22H22FNO4S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[3-[(3,3-dimethyl-1,1-dioxo-2H-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccc3c(c2)C(C)(C)CS3(=O)=O)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C22H22FNO4S/c1-13-16(17-10-15(23)5-6-19(17)24(13)11-21(25)26)8-14-4-7-20-18(9-14)22(2,3)12-29(20,27)28/h4-7,9-10H,8,11-12H2,1-3H3,(H,25,26) |
| InChIKey | LXQHCJJUIKXNEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|