About 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid
2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 138662409) has the molecular formula C21H18FNO4S
and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| PubChem CID | 138662409 |
| Molecular Formula | C21H18FNO4S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C(C)C2=CS(=O)(=O)c3ccccc32)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C21H18FNO4S/c1-12(17-11-28(26,27)19-6-4-3-5-15(17)19)21-13(2)23(10-20(24)25)18-8-7-14(22)9-16(18)21/h3-9,11-12H,10H2,1-2H3,(H,24,25) |
| InChIKey | AUTLWRBXDBACPU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid?
The IUPAC name of 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid (CID 138662409) is 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid?
The canonical SMILES for 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid is Cc1c(C(C)C2=CS(=O)(=O)c3ccccc32)c2cc(F)ccc2n1CC(=O)O.
What is the InChIKey of 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid?
The InChIKey is AUTLWRBXDBACPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FNO4S/c1-12(17-11-28(26,27)19-6-4-3-5-15(17)19)21-13(2)23(10-20(24)25)18-8-7-14(22)9-16(18)21/h3-9,11-12H,10H2,1-2H3,(H,24,25).
What are the key properties of 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid?
2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid has a molecular weight of 399.44 g/mol, XLogP of 4.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[1-(1,1-dioxo-1-benzothiophen-3-yl)ethyl]-5-fluoro-2-methylindol-1-yl]acetic acid is sourced from PubChem (CID 138662409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).