C20H18FNO4S — CID 138662881
2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 138662881) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 138662881 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccc3c(c2)CCS3(=O)=O)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C20H18FNO4S/c1-12-16(9-13-2-5-19-14(8-13)6-7-27(19,25)26)17-10-15(21)3-4-18(17)22(12)11-20(23)24/h2-5,8,10H,6-7,9,11H2,1H3,(H,23,24) |
| InChIKey | CVMCUBIEUMCWAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|