About (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid
(2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid (PubChem CID 138663022) has the molecular formula C8H6ClF2N3O2
and a molecular weight of 249.60 g/mol. Its IUPAC name is (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid.
Molecular Properties
| Compound Name | (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid |
| PubChem CID | 138663022 |
| Molecular Formula | C8H6ClF2N3O2 |
| Molecular Weight | 249.60 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid |
| SMILES | C/C(=N\Nc1nc(F)c(Cl)cc1F)C(=O)O |
| InChI | InChI=1S/C8H6ClF2N3O2/c1-3(8(15)16)13-14-7-5(10)2-4(9)6(11)12-7/h2H,1H3,(H,12,14)(H,15,16)/b13-3+ |
| InChIKey | UMFNLUBEAROQTL-QLKAYGNNSA-N |
| XLogP | 1.89 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid?
The IUPAC name of (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid (CID 138663022) is (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid.
What is the SMILES notation for (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid?
The canonical SMILES for (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid is C/C(=N\Nc1nc(F)c(Cl)cc1F)C(=O)O.
What is the InChIKey of (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid?
The InChIKey is UMFNLUBEAROQTL-QLKAYGNNSA-N. The full InChI is InChI=1S/C8H6ClF2N3O2/c1-3(8(15)16)13-14-7-5(10)2-4(9)6(11)12-7/h2H,1H3,(H,12,14)(H,15,16)/b13-3+.
What are the key properties of (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid?
(2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid has a molecular weight of 249.60 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(5-chloro-3,6-difluoro-2-pyridinyl)hydrazinylidene]propanoic acid is sourced from PubChem (CID 138663022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).