About 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine
1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine (PubChem CID 138663343) has the molecular formula C12H17NO2S3
and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine |
| PubChem CID | 138663343 |
| Molecular Formula | C12H17NO2S3 |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine |
| SMILES | O=S(=O)(c1cccs1)[C@H]1CSC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C12H17NO2S3/c14-18(15,12-4-3-7-17-12)11-9-16-8-10(11)13-5-1-2-6-13/h3-4,7,10-11H,1-2,5-6,8-9H2/t10-,11-/m0/s1 |
| InChIKey | XLDBKBVKUHJREU-QWRGUYRKSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine?
The IUPAC name of 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine (CID 138663343) is 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine.
What is the SMILES notation for 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine?
The canonical SMILES for 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine is O=S(=O)(c1cccs1)[C@H]1CSC[C@@H]1N1CCCC1.
What is the InChIKey of 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine?
The InChIKey is XLDBKBVKUHJREU-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H17NO2S3/c14-18(15,12-4-3-7-17-12)11-9-16-8-10(11)13-5-1-2-6-13/h3-4,7,10-11H,1-2,5-6,8-9H2/t10-,11-/m0/s1.
What are the key properties of 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine?
1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine has a molecular weight of 303.47 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine is sourced from PubChem (CID 138663343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).