C24H37FN2 — CID 138663518
N'-[(2E,5E,7Z)-5-fluoro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9,9-dimethyl-3-propyldeca-2,5,7-trienyl]ethanimidamide (PubChem CID 138663518) has the molecular formula C24H37FN2 and a molecular weight of 372.57 g/mol. Its IUPAC name is N'-[(2E,5E,7Z)-5-fluoro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9,9-dimethyl-3-propyldeca-2,5,7-trienyl]ethanimidamide.
| Compound Name | N'-[(2E,5E,7Z)-5-fluoro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9,9-dimethyl-3-propyldeca-2,5,7-trienyl]ethanimidamide |
|---|---|
| PubChem CID | 138663518 |
| Molecular Formula | C24H37FN2 |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | N'-[(2E,5E,7Z)-5-fluoro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9,9-dimethyl-3-propyldeca-2,5,7-trienyl]ethanimidamide |
| SMILES | C=C/C=C(\C=C/C)C(/C/N=C(\C)N)=C(/CCC)C/C(F)=C\C=C/C(C)(C)C |
| InChI | InChI=1S/C24H37FN2/c1-8-12-20(13-9-2)23(18-27-19(4)26)21(14-10-3)17-22(25)15-11-16-24(5,6)7/h8-9,11-13,15-16H,1,10,14,17-18H2,2-7H3,(H2,26,27)/b13-9-,16-11-,20-12+,22-15+,23-21- |
| InChIKey | FYWOHRUDHCTLJQ-MZCKAKFYSA-N |
| XLogP | 6.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|