C28H33F3N4O3 — CID 138663573
N-[[(4S,6R)-6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 138663573) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-[[(4S,6R)-6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[[(4S,6R)-6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138663573 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-[[(4S,6R)-6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC1[C@@H](CCN2CCc3ccccc3C2)OC(C)(C)O[C@@H]1CNC(=O)c1cn2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-18-23(11-13-34-12-10-19-6-4-5-7-20(19)15-34)37-27(2,3)38-24(18)14-32-26(36)22-17-35-16-21(28(29,30)31)8-9-25(35)33-22/h4-9,16-18,23-24H,10-15H2,1-3H3,(H,32,36)/t18?,23-,24-/m1/s1 |
| InChIKey | MJFDNUWMJILCSQ-VBTAZDKBSA-N |
| XLogP | 4.69 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |