About 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol
1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol (PubChem CID 138663722) has the molecular formula C10H7F3N2O
and a molecular weight of 228.17 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol.
Molecular Properties
| Compound Name | 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol |
| PubChem CID | 138663722 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol |
| SMILES | C=C(O)c1cn2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C10H7F3N2O/c1-6(16)8-5-15-4-7(10(11,12)13)2-3-9(15)14-8/h2-5,16H,1H2 |
| InChIKey | KHLMYEKYKFVMAR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol?
The IUPAC name of 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol (CID 138663722) is 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol.
What is the SMILES notation for 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol?
The canonical SMILES for 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol is C=C(O)c1cn2cc(C(F)(F)F)ccc2n1.
What is the InChIKey of 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol?
The InChIKey is KHLMYEKYKFVMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O/c1-6(16)8-5-15-4-7(10(11,12)13)2-3-9(15)14-8/h2-5,16H,1H2.
What are the key properties of 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol?
1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol has a molecular weight of 228.17 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethenol is sourced from PubChem (CID 138663722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).