C17H25N5O6S — CID 138664151
S-methyl (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]pentanethioate (PubChem CID 138664151) has the molecular formula C17H25N5O6S and a molecular weight of 427.48 g/mol. Its IUPAC name is S-methyl (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]pentanethioate.
| Compound Name | S-methyl (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]pentanethioate |
|---|---|
| PubChem CID | 138664151 |
| Molecular Formula | C17H25N5O6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | S-methyl (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]pentanethioate |
| SMILES | CSC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](C)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H25N5O6S/c1-10(20-12(23)7-9-22-13(24)5-6-14(22)25)15(26)21-11(16(27)29-2)4-3-8-19-17(18)28/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,20,23)(H,21,26)(H3,18,19,28)/t10-,11-/m0/s1 |
| InChIKey | WPVQTMULDUZBQJ-QWRGUYRKSA-N |
| XLogP | -1.37 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|