About 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline
4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline (PubChem CID 138664419) has the molecular formula C23H20Cl2FN3
and a molecular weight of 428.34 g/mol. Its IUPAC name is 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline.
Molecular Properties
| Compound Name | 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline |
| PubChem CID | 138664419 |
| Molecular Formula | C23H20Cl2FN3 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline |
| SMILES | Fc1ccc2nccc(C3CCC(Cc4nc5cc(Cl)c(Cl)cc5[nH]4)CC3)c2c1 |
| InChI | InChI=1S/C23H20Cl2FN3/c24-18-11-21-22(12-19(18)25)29-23(28-21)9-13-1-3-14(4-2-13)16-7-8-27-20-6-5-15(26)10-17(16)20/h5-8,10-14H,1-4,9H2,(H,28,29) |
| InChIKey | LNIINYQLNPSBPX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline?
The IUPAC name of 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline (CID 138664419) is 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline.
What is the SMILES notation for 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline?
The canonical SMILES for 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline is Fc1ccc2nccc(C3CCC(Cc4nc5cc(Cl)c(Cl)cc5[nH]4)CC3)c2c1.
What is the InChIKey of 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline?
The InChIKey is LNIINYQLNPSBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2FN3/c24-18-11-21-22(12-19(18)25)29-23(28-21)9-13-1-3-14(4-2-13)16-7-8-27-20-6-5-15(26)10-17(16)20/h5-8,10-14H,1-4,9H2,(H,28,29).
What are the key properties of 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline?
4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline has a molecular weight of 428.34 g/mol, XLogP of 7.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]cyclohexyl]-6-fluoroquinoline is sourced from PubChem (CID 138664419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).