About 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol
4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol (PubChem CID 138664597) has the molecular formula C22H26O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol.
Molecular Properties
| Compound Name | 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol |
| PubChem CID | 138664597 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol |
| SMILES | C=CCc1cc(-c2cc(C)c(O)cc2C(C)C)cc(CC=C)c1O |
| InChI | InChI=1S/C22H26O2/c1-6-8-16-11-18(12-17(9-7-2)22(16)24)20-10-15(5)21(23)13-19(20)14(3)4/h6-7,10-14,23-24H,1-2,8-9H2,3-5H3 |
| InChIKey | ABBKZMKIMDFLGE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol?
The IUPAC name of 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol (CID 138664597) is 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol.
What is the SMILES notation for 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol?
The canonical SMILES for 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol is C=CCc1cc(-c2cc(C)c(O)cc2C(C)C)cc(CC=C)c1O.
What is the InChIKey of 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol?
The InChIKey is ABBKZMKIMDFLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O2/c1-6-8-16-11-18(12-17(9-7-2)22(16)24)20-10-15(5)21(23)13-19(20)14(3)4/h6-7,10-14,23-24H,1-2,8-9H2,3-5H3.
What are the key properties of 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol?
4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol has a molecular weight of 322.45 g/mol, XLogP of 5.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-hydroxy-3,5-bis(prop-2-enyl)phenyl]-2-methyl-5-propan-2-ylphenol is sourced from PubChem (CID 138664597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).