C10H5F9O4 — CID 138664789
2-O-[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 1-O-[(Z)-3,4,4,4-tetrafluorobut-2-enyl] oxalate (PubChem CID 138664789) has the molecular formula C10H5F9O4 and a molecular weight of 360.13 g/mol. Its IUPAC name is 2-O-[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 1-O-[(Z)-3,4,4,4-tetrafluorobut-2-enyl] oxalate.
| Compound Name | 2-O-[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 1-O-[(Z)-3,4,4,4-tetrafluorobut-2-enyl] oxalate |
|---|---|
| PubChem CID | 138664789 |
| Molecular Formula | C10H5F9O4 |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-O-[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 1-O-[(Z)-3,4,4,4-tetrafluorobut-2-enyl] oxalate |
| SMILES | O=C(OC/C=C(\F)C(F)(F)F)C(=O)OC/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C10H5F9O4/c11-4(6(13)10(17,18)19)3-23-8(21)7(20)22-2-1-5(12)9(14,15)16/h1H,2-3H2/b5-1-,6-4+ |
| InChIKey | IZPAITSLHRFYHW-UAJDWXFYSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|