C20H28FN5 — CID 138665611
(1E)-4-N-[(5-fluoro-3a,4-dihydro-1H-benzimidazol-2-yl)methyl]-1-N,4-N,2-trimethyl-1-(methylideneamino)-3-propan-2-ylidenepenta-1,4-diene-1,4-diamine (PubChem CID 138665611) has the molecular formula C20H28FN5 and a molecular weight of 357.48 g/mol. Its IUPAC name is (1E)-4-N-[(5-fluoro-3a,4-dihydro-1H-benzimidazol-2-yl)methyl]-1-N,4-N,2-trimethyl-1-(methylideneamino)-3-propan-2-ylidenepenta-1,4-diene-1,4-diamine.
| Compound Name | (1E)-4-N-[(5-fluoro-3a,4-dihydro-1H-benzimidazol-2-yl)methyl]-1-N,4-N,2-trimethyl-1-(methylideneamino)-3-propan-2-ylidenepenta-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 138665611 |
| Molecular Formula | C20H28FN5 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (1E)-4-N-[(5-fluoro-3a,4-dihydro-1H-benzimidazol-2-yl)methyl]-1-N,4-N,2-trimethyl-1-(methylideneamino)-3-propan-2-ylidenepenta-1,4-diene-1,4-diamine |
| SMILES | C=N/C(NC)=C(\C)C(C(=C)N(C)CC1=NC2CC(F)=CC=C2N1)=C(C)C |
| InChI | InChI=1S/C20H28FN5/c1-12(2)19(13(3)20(22-5)23-6)14(4)26(7)11-18-24-16-9-8-15(21)10-17(16)25-18/h8-9,17,23H,4-5,10-11H2,1-3,6-7H3,(H,24,25)/b20-13- |
| InChIKey | BTYORIWMTZRIED-MOSHPQCFSA-N |
| XLogP | 3.43 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|