C25H38N4 — CID 138665616
1-[(1E)-2,4-dimethyl-3-[1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]ethenyl]penta-1,3-dienyl]-2-(1-methylcyclopropyl)hydrazine (PubChem CID 138665616) has the molecular formula C25H38N4 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-[(1E)-2,4-dimethyl-3-[1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]ethenyl]penta-1,3-dienyl]-2-(1-methylcyclopropyl)hydrazine.
| Compound Name | 1-[(1E)-2,4-dimethyl-3-[1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]ethenyl]penta-1,3-dienyl]-2-(1-methylcyclopropyl)hydrazine |
|---|---|
| PubChem CID | 138665616 |
| Molecular Formula | C25H38N4 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 1-[(1E)-2,4-dimethyl-3-[1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]ethenyl]penta-1,3-dienyl]-2-(1-methylcyclopropyl)hydrazine |
| SMILES | C=C(C(=C(C)C)/C(C)=C/NNC1(C)CC1)N1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C25H38N4/c1-19(2)24(21(4)17-26-27-25(6)10-11-25)22(5)29-14-12-28(13-15-29)18-23-9-7-8-20(3)16-23/h7-9,16-17,26-27H,5,10-15,18H2,1-4,6H3/b21-17+ |
| InChIKey | KWSGINMKOAONCR-HEHNFIMWSA-N |
| XLogP | 4.51 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|