C17H30O2 — CID 138665666
[1-[(6S)-4,6-dimethylcyclohex-3-en-1-yl]-2,2-dimethylpentyl] acetate (PubChem CID 138665666) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is [1-[(6S)-4,6-dimethylcyclohex-3-en-1-yl]-2,2-dimethylpentyl] acetate.
| Compound Name | [1-[(6S)-4,6-dimethylcyclohex-3-en-1-yl]-2,2-dimethylpentyl] acetate |
|---|---|
| PubChem CID | 138665666 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | [1-[(6S)-4,6-dimethylcyclohex-3-en-1-yl]-2,2-dimethylpentyl] acetate |
| SMILES | CCCC(C)(C)C(OC(C)=O)C1CC=C(C)C[C@@H]1C |
| InChI | InChI=1S/C17H30O2/c1-7-10-17(5,6)16(19-14(4)18)15-9-8-12(2)11-13(15)3/h8,13,15-16H,7,9-11H2,1-6H3/t13-,15?,16?/m0/s1 |
| InChIKey | BYDVRJWQHNVHHB-JEYLPNPQSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|