C17H24N4OS — CID 138666125
3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-methyl-1,3-thiazol-4-yl)but-2-enamide (PubChem CID 138666125) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-methyl-1,3-thiazol-4-yl)but-2-enamide.
| Compound Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-methyl-1,3-thiazol-4-yl)but-2-enamide |
|---|---|
| PubChem CID | 138666125 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-methyl-1,3-thiazol-4-yl)but-2-enamide |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)Nc1csc(C)n1)=C(C)C |
| InChI | InChI=1S/C17H24N4OS/c1-10(2)14(16(22)20-13-9-23-12(4)19-13)11(3)15(18-6)21-17(5)7-8-17/h9,21H,6-8H2,1-5H3,(H,20,22)/b15-11- |
| InChIKey | RUEPGLFFBZFZDR-PTNGSMBKSA-N |
| XLogP | 3.80 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|