About [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate
[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate (PubChem CID 138666186) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate.
Molecular Properties
| Compound Name | [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate |
| PubChem CID | 138666186 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate |
| SMILES | C=C/C=C\C(=C/C=C)COC(=O)CC(N)=O |
| InChI | InChI=1S/C12H15NO3/c1-3-5-7-10(6-4-2)9-16-12(15)8-11(13)14/h3-7H,1-2,8-9H2,(H2,13,14)/b7-5-,10-6+ |
| InChIKey | RGIKFKWMMIUWPL-ZPRNNRRZSA-N |
| XLogP | 1.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate?
The IUPAC name of [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate (CID 138666186) is [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate.
What is the SMILES notation for [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate?
The canonical SMILES for [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate is C=C/C=C\C(=C/C=C)COC(=O)CC(N)=O.
What is the InChIKey of [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate?
The InChIKey is RGIKFKWMMIUWPL-ZPRNNRRZSA-N. The full InChI is InChI=1S/C12H15NO3/c1-3-5-7-10(6-4-2)9-16-12(15)8-11(13)14/h3-7H,1-2,8-9H2,(H2,13,14)/b7-5-,10-6+.
What are the key properties of [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate?
[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate has a molecular weight of 221.26 g/mol, XLogP of 1.26, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl] 3-amino-3-oxopropanoate is sourced from PubChem (CID 138666186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).