C21H29N5O — CID 138666189
N-[(5-cyclopropylpyrazin-2-yl)methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide (PubChem CID 138666189) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[(5-cyclopropylpyrazin-2-yl)methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide.
| Compound Name | N-[(5-cyclopropylpyrazin-2-yl)methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 138666189 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[(5-cyclopropylpyrazin-2-yl)methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)NCc1cnc(C2CC2)cn1)=C(C)C |
| InChI | InChI=1S/C21H29N5O/c1-13(2)18(14(3)19(22-5)26-21(4)8-9-21)20(27)25-11-16-10-24-17(12-23-16)15-6-7-15/h10,12,15,26H,5-9,11H2,1-4H3,(H,25,27)/b19-14- |
| InChIKey | ZOXNVZCQAKHWTH-RGEXLXHISA-N |
| XLogP | 3.38 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|