About 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride
5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride (PubChem CID 138666211) has the molecular formula C6H10FN3
and a molecular weight of 143.17 g/mol. Its IUPAC name is 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride.
Molecular Properties
| Compound Name | 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride |
| PubChem CID | 138666211 |
| Molecular Formula | C6H10FN3 |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride |
| SMILES | [H]/N=C(\F)C1=C(N)CNCC1 |
| InChI | InChI=1S/C6H10FN3/c7-6(9)4-1-2-10-3-5(4)8/h9-10H,1-3,8H2/b9-6- |
| InChIKey | QFPIENDVIXBGGL-TWGQIWQCSA-N |
| XLogP | 0.14 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride?
The IUPAC name of 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride (CID 138666211) is 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride.
What is the SMILES notation for 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride?
The canonical SMILES for 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride is [H]/N=C(\F)C1=C(N)CNCC1.
What is the InChIKey of 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride?
The InChIKey is QFPIENDVIXBGGL-TWGQIWQCSA-N. The full InChI is InChI=1S/C6H10FN3/c7-6(9)4-1-2-10-3-5(4)8/h9-10H,1-3,8H2/b9-6-.
What are the key properties of 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride?
5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride has a molecular weight of 143.17 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,2,3,6-tetrahydropyridine-4-carboximidoyl fluoride is sourced from PubChem (CID 138666211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).