C21H31N5O2 — CID 138666463
(3E)-N-[(6-methoxy-2-methylpyrimidin-4-yl)methyl]-3-[[(1-methylcyclopropyl)amino]-(methylideneamino)methylidene]-2-propan-2-ylidenepentanamide (PubChem CID 138666463) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (3E)-N-[(6-methoxy-2-methylpyrimidin-4-yl)methyl]-3-[[(1-methylcyclopropyl)amino]-(methylideneamino)methylidene]-2-propan-2-ylidenepentanamide.
| Compound Name | (3E)-N-[(6-methoxy-2-methylpyrimidin-4-yl)methyl]-3-[[(1-methylcyclopropyl)amino]-(methylideneamino)methylidene]-2-propan-2-ylidenepentanamide |
|---|---|
| PubChem CID | 138666463 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (3E)-N-[(6-methoxy-2-methylpyrimidin-4-yl)methyl]-3-[[(1-methylcyclopropyl)amino]-(methylideneamino)methylidene]-2-propan-2-ylidenepentanamide |
| SMILES | C=N/C(NC1(C)CC1)=C(\CC)C(C(=O)NCc1cc(OC)nc(C)n1)=C(C)C |
| InChI | InChI=1S/C21H31N5O2/c1-8-16(19(22-6)26-21(5)9-10-21)18(13(2)3)20(27)23-12-15-11-17(28-7)25-14(4)24-15/h11,26H,6,8-10,12H2,1-5,7H3,(H,23,27)/b19-16- |
| InChIKey | CMRKQOOOVCFROV-MNDPQUGUSA-N |
| XLogP | 3.21 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|