About 8-propylpyrrolo[1,2-a]pyrazine
8-propylpyrrolo[1,2-a]pyrazine (PubChem CID 138666907) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 8-propylpyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-propylpyrrolo[1,2-a]pyrazine |
| PubChem CID | 138666907 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 8-propylpyrrolo[1,2-a]pyrazine |
| SMILES | CCCc1ccn2ccncc12 |
| InChI | InChI=1S/C10H12N2/c1-2-3-9-4-6-12-7-5-11-8-10(9)12/h4-8H,2-3H2,1H3 |
| InChIKey | QFPGTJUFCNEFBM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-propylpyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propylpyrrolo[1,2-a]pyrazine?
The IUPAC name of 8-propylpyrrolo[1,2-a]pyrazine (CID 138666907) is 8-propylpyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 8-propylpyrrolo[1,2-a]pyrazine?
The canonical SMILES for 8-propylpyrrolo[1,2-a]pyrazine is CCCc1ccn2ccncc12.
What is the InChIKey of 8-propylpyrrolo[1,2-a]pyrazine?
The InChIKey is QFPGTJUFCNEFBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-3-9-4-6-12-7-5-11-8-10(9)12/h4-8H,2-3H2,1H3.
What are the key properties of 8-propylpyrrolo[1,2-a]pyrazine?
8-propylpyrrolo[1,2-a]pyrazine has a molecular weight of 160.22 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propylpyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 138666907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).