C8H12N4 — CID 138667261
1-(1H-1,2,4-triazol-5-ylmethyl)-3,6-dihydro-2H-pyridine (PubChem CID 138667261) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-ylmethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(1H-1,2,4-triazol-5-ylmethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 138667261 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-ylmethyl)-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(Cc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C8H12N4/c1-2-4-12(5-3-1)6-8-9-7-10-11-8/h1-2,7H,3-6H2,(H,9,10,11) |
| InChIKey | FKSVGTNGZRZEFJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|