About (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine
(Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine (PubChem CID 138667307) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine.
Molecular Properties
| Compound Name | (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine |
| PubChem CID | 138667307 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine |
| SMILES | C=CC(CS(C)(C)C)N/C(C)=C\CC |
| InChI | InChI=1S/C12H25NS/c1-7-9-11(3)13-12(8-2)10-14(4,5)6/h8-9,12-13H,2,7,10H2,1,3-6H3/b11-9- |
| InChIKey | IDDGMDPDZKGSMB-LUAWRHEFSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine?
The IUPAC name of (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine (CID 138667307) is (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine.
What is the SMILES notation for (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine?
The canonical SMILES for (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine is C=CC(CS(C)(C)C)N/C(C)=C\CC.
What is the InChIKey of (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine?
The InChIKey is IDDGMDPDZKGSMB-LUAWRHEFSA-N. The full InChI is InChI=1S/C12H25NS/c1-7-9-11(3)13-12(8-2)10-14(4,5)6/h8-9,12-13H,2,7,10H2,1,3-6H3/b11-9-.
What are the key properties of (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine?
(Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine has a molecular weight of 215.41 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[1-(trimethyl-λ4-sulfanyl)but-3-en-2-yl]pent-2-en-2-amine is sourced from PubChem (CID 138667307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).