About 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide
4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide (PubChem CID 138667739) has the molecular formula C14H14F4O4S
and a molecular weight of 354.32 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide |
| PubChem CID | 138667739 |
| Molecular Formula | C14H14F4O4S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)c2ccc(OC3CCOCC3)c(C(F)F)c2CC1(F)F |
| InChI | InChI=1S/C14H14F4O4S/c15-13(16)12-9-7-14(17,18)23(19,20)11(9)2-1-10(12)22-8-3-5-21-6-4-8/h1-2,8,13H,3-7H2 |
| InChIKey | YSQHOXGPETWBPK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide?
The IUPAC name of 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide (CID 138667739) is 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide.
What is the SMILES notation for 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide?
The canonical SMILES for 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide is O=S1(=O)c2ccc(OC3CCOCC3)c(C(F)F)c2CC1(F)F.
What is the InChIKey of 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide?
The InChIKey is YSQHOXGPETWBPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F4O4S/c15-13(16)12-9-7-14(17,18)23(19,20)11(9)2-1-10(12)22-8-3-5-21-6-4-8/h1-2,8,13H,3-7H2.
What are the key properties of 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide?
4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide has a molecular weight of 354.32 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2,2-difluoro-5-(oxan-4-yloxy)-3H-1-benzothiophene 1,1-dioxide is sourced from PubChem (CID 138667739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).