About 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde
1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde (PubChem CID 138667814) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde |
| PubChem CID | 138667814 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde |
| SMILES | Cn1c(=O)cnc2ncc(C=O)cc21 |
| InChI | InChI=1S/C9H7N3O2/c1-12-7-2-6(5-13)3-10-9(7)11-4-8(12)14/h2-5H,1H3 |
| InChIKey | GPBJMWCMNZYDNM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde?
The IUPAC name of 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde (CID 138667814) is 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde.
What is the SMILES notation for 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde?
The canonical SMILES for 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde is Cn1c(=O)cnc2ncc(C=O)cc21.
What is the InChIKey of 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde?
The InChIKey is GPBJMWCMNZYDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c1-12-7-2-6(5-13)3-10-9(7)11-4-8(12)14/h2-5H,1H3.
What are the key properties of 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde?
1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde has a molecular weight of 189.17 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-oxopyrido[2,3-b]pyrazine-7-carbaldehyde is sourced from PubChem (CID 138667814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).