About N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine
N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine (PubChem CID 138667921) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine |
| PubChem CID | 138667921 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine |
| SMILES | C/C=N/C/C=C\C(C)=C/CC |
| InChI | InChI=1S/C10H17N/c1-4-7-10(3)8-6-9-11-5-2/h5-8H,4,9H2,1-3H3/b8-6-,10-7-,11-5+ |
| InChIKey | PNLCYZSHRGSSKH-ZINMCJGOSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine?
The IUPAC name of N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine (CID 138667921) is N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine.
What is the SMILES notation for N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine?
The canonical SMILES for N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine is C/C=N/C/C=C\C(C)=C/CC.
What is the InChIKey of N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine?
The InChIKey is PNLCYZSHRGSSKH-ZINMCJGOSA-N. The full InChI is InChI=1S/C10H17N/c1-4-7-10(3)8-6-9-11-5-2/h5-8H,4,9H2,1-3H3/b8-6-,10-7-,11-5+.
What are the key properties of N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine?
N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine has a molecular weight of 151.25 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-4-methylhepta-2,4-dienyl]ethanimine is sourced from PubChem (CID 138667921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).