About 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole
4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole (PubChem CID 138668061) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole.
Molecular Properties
| Compound Name | 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole |
| PubChem CID | 138668061 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole |
| SMILES | C=CC1=C(CC)NSC1 |
| InChI | InChI=1S/C7H11NS/c1-3-6-5-9-8-7(6)4-2/h3,8H,1,4-5H2,2H3 |
| InChIKey | CHSQDOUANMMHOM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole?
The IUPAC name of 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole (CID 138668061) is 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole.
What is the SMILES notation for 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole?
The canonical SMILES for 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole is C=CC1=C(CC)NSC1.
What is the InChIKey of 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole?
The InChIKey is CHSQDOUANMMHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-3-6-5-9-8-7(6)4-2/h3,8H,1,4-5H2,2H3.
What are the key properties of 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole?
4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole has a molecular weight of 141.24 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-3-ethyl-2,5-dihydro-1,2-thiazole is sourced from PubChem (CID 138668061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).