C19H27N — CID 138668494
2,2-dimethyl-N-[1-(5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)ethenyl]pentan-3-imine (PubChem CID 138668494) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[1-(5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)ethenyl]pentan-3-imine.
| Compound Name | 2,2-dimethyl-N-[1-(5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)ethenyl]pentan-3-imine |
|---|---|
| PubChem CID | 138668494 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2,2-dimethyl-N-[1-(5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)ethenyl]pentan-3-imine |
| SMILES | C=C(/N=C(\CC)C(C)(C)C)C1=CC=CC(C(=C)C)C=C1 |
| InChI | InChI=1S/C19H27N/c1-8-18(19(5,6)7)20-15(4)17-11-9-10-16(12-13-17)14(2)3/h9-13,16H,2,4,8H2,1,3,5-7H3/b20-18+ |
| InChIKey | ULXYVVUJIJVNAG-CZIZESTLSA-N |
| XLogP | 5.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|