C11H13N3O2 — CID 138668866
1-[(2E,4Z)-5-amino-4-methanimidoylpenta-2,4-dienoyl]-2,3-dihydropyridin-6-one (PubChem CID 138668866) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-[(2E,4Z)-5-amino-4-methanimidoylpenta-2,4-dienoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(2E,4Z)-5-amino-4-methanimidoylpenta-2,4-dienoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138668866 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-[(2E,4Z)-5-amino-4-methanimidoylpenta-2,4-dienoyl]-2,3-dihydropyridin-6-one |
| SMILES | [H]/N=C/C(=C\N)/C=C/C(=O)N1CCC=CC1=O |
| InChI | InChI=1S/C11H13N3O2/c12-7-9(8-13)4-5-11(16)14-6-2-1-3-10(14)15/h1,3-5,7-8,12H,2,6,13H2/b5-4+,9-8-,12-7+ |
| InChIKey | ROLUENCXRCSELD-KOFJUIKUSA-N |
| XLogP | 0.35 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|