C20H22FN3O2 — CID 138668932
3-[(2-fluoro-4-pyridinyl)methyl]-6-[(1S,2S)-2-hydroxycyclohexyl]-2-methyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 138668932) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[(2-fluoro-4-pyridinyl)methyl]-6-[(1S,2S)-2-hydroxycyclohexyl]-2-methyl-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 3-[(2-fluoro-4-pyridinyl)methyl]-6-[(1S,2S)-2-hydroxycyclohexyl]-2-methyl-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 138668932 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[(2-fluoro-4-pyridinyl)methyl]-6-[(1S,2S)-2-hydroxycyclohexyl]-2-methyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1nc2c(cc1Cc1ccnc(F)c1)C(=O)N([C@H]1CCCC[C@@H]1O)C2 |
| InChI | InChI=1S/C20H22FN3O2/c1-12-14(8-13-6-7-22-19(21)9-13)10-15-16(23-12)11-24(20(15)26)17-4-2-3-5-18(17)25/h6-7,9-10,17-18,25H,2-5,8,11H2,1H3/t17-,18-/m0/s1 |
| InChIKey | HFRZHFKDSUTNJN-ROUUACIJSA-N |
| XLogP | 2.77 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|