C13H12F3N3O2 — CID 138669591
1-[(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138669591) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 1-[(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138669591 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)/C=C/c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)9-18-8-10(7-17-18)4-5-12(21)19-6-2-1-3-11(19)20/h1,3-5,7-8H,2,6,9H2/b5-4+ |
| InChIKey | XGUCFEFXNODYMR-SNAWJCMRSA-N |
| XLogP | 1.77 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|