C13H15F3N2O3 — CID 138669592
[(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl] 2,2-dimethylpropanoate (PubChem CID 138669592) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is [(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138669592 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [(E)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)/C=C/c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-12(2,3)11(20)21-10(19)5-4-9-6-17-18(7-9)8-13(14,15)16/h4-7H,8H2,1-3H3/b5-4+ |
| InChIKey | PMQZEUDSENYWKI-SNAWJCMRSA-N |
| XLogP | 2.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|