About 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one
2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 138669968) has the molecular formula C14H16FN3O2
and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 138669968 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | NC/C(=C/F)COc1ccc2c(n1)CN(C1CC1)C2=O |
| InChI | InChI=1S/C14H16FN3O2/c15-5-9(6-16)8-20-13-4-3-11-12(17-13)7-18(14(11)19)10-1-2-10/h3-5,10H,1-2,6-8,16H2/b9-5- |
| InChIKey | ZZIDZDYFOHUOQF-UITAMQMPSA-N |
| XLogP | 1.39 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one (CID 138669968) is 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one is NC/C(=C/F)COc1ccc2c(n1)CN(C1CC1)C2=O.
What is the InChIKey of 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one?
The InChIKey is ZZIDZDYFOHUOQF-UITAMQMPSA-N. The full InChI is InChI=1S/C14H16FN3O2/c15-5-9(6-16)8-20-13-4-3-11-12(17-13)7-18(14(11)19)10-1-2-10/h3-5,10H,1-2,6-8,16H2/b9-5-.
What are the key properties of 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one?
2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one has a molecular weight of 277.30 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-6-cyclopropyl-7H-pyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 138669968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).