About 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one
1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138670145) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one |
| PubChem CID | 138670145 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C14H19NO2/c16-13-8-4-5-11-15(13)14(17)10-9-12-6-2-1-3-7-12/h4,8-10,12H,1-3,5-7,11H2/b10-9+ |
| InChIKey | NAXQDAGQRJMDPM-MDZDMXLPSA-N |
| XLogP | 2.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one?
The IUPAC name of 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one (CID 138670145) is 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one is O=C1C=CCCN1C(=O)/C=C/C1CCCCC1.
What is the InChIKey of 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one?
The InChIKey is NAXQDAGQRJMDPM-MDZDMXLPSA-N. The full InChI is InChI=1S/C14H19NO2/c16-13-8-4-5-11-15(13)14(17)10-9-12-6-2-1-3-7-12/h4,8-10,12H,1-3,5-7,11H2/b10-9+.
What are the key properties of 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one?
1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one has a molecular weight of 233.31 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-cyclohexylprop-2-enoyl]-2,3-dihydropyridin-6-one is sourced from PubChem (CID 138670145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).