C7H12N2O — CID 138670225
1-(ethylamino)-2,3-dihydropyridin-6-one (PubChem CID 138670225) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-(ethylamino)-2,3-dihydropyridin-6-one.
| Compound Name | 1-(ethylamino)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138670225 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1-(ethylamino)-2,3-dihydropyridin-6-one |
| SMILES | CCNN1CCC=CC1=O |
| InChI | InChI=1S/C7H12N2O/c1-2-8-9-6-4-3-5-7(9)10/h3,5,8H,2,4,6H2,1H3 |
| InChIKey | DSBGEKDYPNSMNI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |