C24H37F3N4O2 — CID 138670363
tert-butyl N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]carbamate (PubChem CID 138670363) has the molecular formula C24H37F3N4O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 138670363 |
| Molecular Formula | C24H37F3N4O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | tert-butyl N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CCN2CCc3cnc(CCC(F)(F)F)nc3CC2)CC1 |
| InChI | InChI=1S/C24H37F3N4O2/c1-23(2,3)33-22(32)29-19-6-4-17(5-7-19)9-13-31-14-10-18-16-28-21(8-12-24(25,26)27)30-20(18)11-15-31/h16-17,19H,4-15H2,1-3H3,(H,29,32) |
| InChIKey | BEUBQWJSWGITEE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |