C25H20FNO4S — CID 138670556
4-[(1S)-1-[[2-[2-(4-fluorophenyl)ethynyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carbonyl]amino]ethyl]benzoic acid (PubChem CID 138670556) has the molecular formula C25H20FNO4S and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-[(1S)-1-[[2-[2-(4-fluorophenyl)ethynyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[2-[2-(4-fluorophenyl)ethynyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 138670556 |
| Molecular Formula | C25H20FNO4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-[(1S)-1-[[2-[2-(4-fluorophenyl)ethynyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1c(C#Cc2ccc(F)cc2)sc2c1CCOC2)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H20FNO4S/c1-15(17-5-7-18(8-6-17)25(29)30)27-24(28)23-20-12-13-31-14-22(20)32-21(23)11-4-16-2-9-19(26)10-3-16/h2-3,5-10,15H,12-14H2,1H3,(H,27,28)(H,29,30)/t15-/m0/s1 |
| InChIKey | JODYCIPGATWVBC-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|