C12H18F3N3OS — CID 138670633
4-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]butan-1-amine (PubChem CID 138670633) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is 4-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]butan-1-amine.
| Compound Name | 4-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]butan-1-amine |
|---|---|
| PubChem CID | 138670633 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]butan-1-amine |
| SMILES | NCCCCN1CCc2sc(OCC(F)(F)F)nc2C1 |
| InChI | InChI=1S/C12H18F3N3OS/c13-12(14,15)8-19-11-17-9-7-18(5-2-1-4-16)6-3-10(9)20-11/h1-8,16H2 |
| InChIKey | NULAFPDXSNTYNM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|