C23H29F3N4O3S — CID 138670766
2-methyl-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]pyridine-3-carboxamide (PubChem CID 138670766) has the molecular formula C23H29F3N4O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-methyl-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138670766 |
| Molecular Formula | C23H29F3N4O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-methyl-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]oxan-3-yl]pyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)N[C@H]1CC[C@H](CCN2CCc3nc(OCC(F)(F)F)sc3CC2)OC1 |
| InChI | InChI=1S/C23H29F3N4O3S/c1-15-18(3-2-9-27-15)21(31)28-16-4-5-17(32-13-16)6-10-30-11-7-19-20(8-12-30)34-22(29-19)33-14-23(24,25)26/h2-3,9,16-17H,4-8,10-14H2,1H3,(H,28,31)/t16-,17+/m0/s1 |
| InChIKey | XBNMOXOSTOMNAW-DLBZAZTESA-N |
| XLogP | 3.56 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |