C24H32F3N5O3 — CID 138670790
2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]acetamide (PubChem CID 138670790) has the molecular formula C24H32F3N5O3 and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]acetamide.
| Compound Name | 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 138670790 |
| Molecular Formula | C24H32F3N5O3 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]oxan-3-yl]acetamide |
| SMILES | Cn1cc(CC(=O)N[C@H]2CC[C@H](CCN3CCc4ccc(OCC(F)(F)F)nc4CC3)OC2)cn1 |
| InChI | InChI=1S/C24H32F3N5O3/c1-31-14-17(13-28-31)12-22(33)29-19-3-4-20(34-15-19)7-10-32-9-6-18-2-5-23(30-21(18)8-11-32)35-16-24(25,26)27/h2,5,13-14,19-20H,3-4,6-12,15-16H2,1H3,(H,29,33)/t19-,20+/m0/s1 |
| InChIKey | PCFSBZNPJGRVML-VQTJNVASSA-N |
| XLogP | 2.45 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |