C24H30F4N4O2S — CID 138670793
N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide (PubChem CID 138670793) has the molecular formula C24H30F4N4O2S and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 138670793 |
| Molecular Formula | C24H30F4N4O2S |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-[4-fluoro-4-[2-[2-(2,2,2-trifluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC1CCC(F)(CCN2CCc3nc(OCC(F)(F)F)sc3CC2)CC1 |
| InChI | InChI=1S/C24H30F4N4O2S/c1-16-18(3-2-11-29-16)21(33)30-17-4-8-23(25,9-5-17)10-14-32-12-6-19-20(7-13-32)35-22(31-19)34-15-24(26,27)28/h2-3,11,17H,4-10,12-15H2,1H3,(H,30,33) |
| InChIKey | PNKHRDPVHPGEHT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |