C27H32F3N5OS — CID 138670812
N-[4-[2-[2-(3,3,3-trifluoropropylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide (PubChem CID 138670812) has the molecular formula C27H32F3N5OS and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[4-[2-[2-(3,3,3-trifluoropropylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[4-[2-[2-(3,3,3-trifluoropropylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138670812 |
| Molecular Formula | C27H32F3N5OS |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-[4-[2-[2-(3,3,3-trifluoropropylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CCc3sc(NCCC(F)(F)F)nc3C2)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C27H32F3N5OS/c28-27(29,30)12-14-32-26-34-23-17-35(16-11-24(23)37-26)15-10-18-6-8-19(9-7-18)33-25(36)21-3-1-5-22-20(21)4-2-13-31-22/h1-5,13,18-19H,6-12,14-17H2,(H,32,34)(H,33,36) |
| InChIKey | AXNKQPBWUDKJKK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |