C26H30F3N5OS — CID 138670815
N-[4-[2-[2-(2,2,2-trifluoroethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide (PubChem CID 138670815) has the molecular formula C26H30F3N5OS and a molecular weight of 517.62 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2,2-trifluoroethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2,2-trifluoroethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138670815 |
| Molecular Formula | C26H30F3N5OS |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-[4-[2-[2-(2,2,2-trifluoroethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CCc3sc(NCC(F)(F)F)nc3C2)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C26H30F3N5OS/c27-26(28,29)16-31-25-33-22-15-34(14-11-23(22)36-25)13-10-17-6-8-18(9-7-17)32-24(35)20-3-1-5-21-19(20)4-2-12-30-21/h1-5,12,17-18H,6-11,13-16H2,(H,31,33)(H,32,35) |
| InChIKey | DCJWBLZHTWTONC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |